C8H10Cl3NO3 — CID 141448559
2,2,2-trichloroethyl 3-oxopiperidine-1-carboxylate (PubChem CID 141448559) has the molecular formula C8H10Cl3NO3 and a molecular weight of 274.53 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-oxopiperidine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 141448559 |
| Molecular Formula | C8H10Cl3NO3 |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 2,2,2-trichloroethyl 3-oxopiperidine-1-carboxylate |
| SMILES | O=C1CCCN(C(=O)OCC(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C8H10Cl3NO3/c9-8(10,11)5-15-7(14)12-3-1-2-6(13)4-12/h1-5H2 |
| InChIKey | AWMPNNDCUUENJE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|