C18H31Cl3N2O4S2 — CID 10601771
4-O-tert-butyl 11-O-(2,2,2-trichloroethyl) 1,7-dithia-4,11-diazacyclotetradecane-4,11-dicarboxylate (PubChem CID 10601771) has the molecular formula C18H31Cl3N2O4S2 and a molecular weight of 509.95 g/mol. Its IUPAC name is 4-O-tert-butyl 11-O-(2,2,2-trichloroethyl) 1,7-dithia-4,11-diazacyclotetradecane-4,11-dicarboxylate.
| Compound Name | 4-O-tert-butyl 11-O-(2,2,2-trichloroethyl) 1,7-dithia-4,11-diazacyclotetradecane-4,11-dicarboxylate |
|---|---|
| PubChem CID | 10601771 |
| Molecular Formula | C18H31Cl3N2O4S2 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 4-O-tert-butyl 11-O-(2,2,2-trichloroethyl) 1,7-dithia-4,11-diazacyclotetradecane-4,11-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCSCCCN(C(=O)OCC(Cl)(Cl)Cl)CCCSCC1 |
| InChI | InChI=1S/C18H31Cl3N2O4S2/c1-17(2,3)27-16(25)23-8-12-28-10-4-6-22(7-5-11-29-13-9-23)15(24)26-14-18(19,20)21/h4-14H2,1-3H3 |
| InChIKey | QLUOWDYLGMDYMG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|