C22H22Cl2N4O2 — CID 118271085
(3,5-dichlorophenyl)methyl (3aS,6aR)-2-(1H-indazol-5-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 118271085) has the molecular formula C22H22Cl2N4O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl (3aS,6aR)-2-(1H-indazol-5-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (3,5-dichlorophenyl)methyl (3aS,6aR)-2-(1H-indazol-5-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 118271085 |
| Molecular Formula | C22H22Cl2N4O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (3,5-dichlorophenyl)methyl (3aS,6aR)-2-(1H-indazol-5-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(Cl)c1)N1C[C@H]2CN(Cc3ccc4[nH]ncc4c3)C[C@H]2C1 |
| InChI | InChI=1S/C22H22Cl2N4O2/c23-19-4-15(5-20(24)6-19)13-30-22(29)28-11-17-9-27(10-18(17)12-28)8-14-1-2-21-16(3-14)7-25-26-21/h1-7,17-18H,8-13H2,(H,25,26)/t17-,18+ |
| InChIKey | YMJCEHVQHGMQMO-HDICACEKSA-N |
| XLogP | 4.57 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |