C19H19Cl2N3O5S2 — CID 146190578
(3,5-dichlorophenyl)methyl (3aS,6aS)-2-(5-sulfamoylthiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 146190578) has the molecular formula C19H19Cl2N3O5S2 and a molecular weight of 504.42 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl (3aS,6aS)-2-(5-sulfamoylthiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (3,5-dichlorophenyl)methyl (3aS,6aS)-2-(5-sulfamoylthiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 146190578 |
| Molecular Formula | C19H19Cl2N3O5S2 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | (3,5-dichlorophenyl)methyl (3aS,6aS)-2-(5-sulfamoylthiophene-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2C[C@H]3CN(C(=O)OCc4cc(Cl)cc(Cl)c4)C[C@@H]3C2)s1 |
| InChI | InChI=1S/C19H19Cl2N3O5S2/c20-14-3-11(4-15(21)5-14)10-29-19(26)24-8-12-6-23(7-13(12)9-24)18(25)16-1-2-17(30-16)31(22,27)28/h1-5,12-13H,6-10H2,(H2,22,27,28)/t12-,13-/m0/s1 |
| InChIKey | TXGFGCRDMPPEGX-STQMWFEESA-N |
| XLogP | 3.04 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |