C19H26ClN3O5 — CID 118271841
N-[2-[(2-chloroacetyl)-[2-(4-cyanophenoxy)ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 118271841) has the molecular formula C19H26ClN3O5 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)-[2-(4-cyanophenoxy)ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[2-[(2-chloroacetyl)-[2-(4-cyanophenoxy)ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118271841 |
| Molecular Formula | C19H26ClN3O5 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[2-[(2-chloroacetyl)-[2-(4-cyanophenoxy)ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCN(CCOc1ccc(C#N)cc1)C(=O)CCl |
| InChI | InChI=1S/C19H26ClN3O5/c1-19(2,13-24)17(26)18(27)22-7-8-23(16(25)11-20)9-10-28-15-5-3-14(12-21)4-6-15/h3-6,17,24,26H,7-11,13H2,1-2H3,(H,22,27) |
| InChIKey | BGMQWFRFQPRLPH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|