C19H30ClN3O5 — CID 144594731
(2R)-N-[2-[(2-chloroacetyl)-[2-[4-(methylamino)phenoxy]ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 144594731) has the molecular formula C19H30ClN3O5 and a molecular weight of 415.92 g/mol. Its IUPAC name is (2R)-N-[2-[(2-chloroacetyl)-[2-[4-(methylamino)phenoxy]ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[2-[(2-chloroacetyl)-[2-[4-(methylamino)phenoxy]ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 144594731 |
| Molecular Formula | C19H30ClN3O5 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (2R)-N-[2-[(2-chloroacetyl)-[2-[4-(methylamino)phenoxy]ethyl]amino]ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CNc1ccc(OCCN(CCNC(=O)[C@H](O)C(C)(C)CO)C(=O)CCl)cc1 |
| InChI | InChI=1S/C19H30ClN3O5/c1-19(2,13-24)17(26)18(27)22-8-9-23(16(25)12-20)10-11-28-15-6-4-14(21-3)5-7-15/h4-7,17,21,24,26H,8-13H2,1-3H3,(H,22,27)/t17-/m0/s1 |
| InChIKey | OSZIHUFOQUDIEM-KRWDZBQOSA-N |
| XLogP | 0.67 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|