C17H21NO3 — CID 118275219
4-(2,3-diethylphenyl)benzene-1,2-diol;formamide (PubChem CID 118275219) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(2,3-diethylphenyl)benzene-1,2-diol;formamide.
| Compound Name | 4-(2,3-diethylphenyl)benzene-1,2-diol;formamide |
|---|---|
| PubChem CID | 118275219 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-(2,3-diethylphenyl)benzene-1,2-diol;formamide |
| SMILES | CCc1cccc(-c2ccc(O)c(O)c2)c1CC.NC=O |
| InChI | InChI=1S/C16H18O2.CH3NO/c1-3-11-6-5-7-14(13(11)4-2)12-8-9-15(17)16(18)10-12;2-1-3/h5-10,17-18H,3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | VFTURYODVHOKNS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|