C10H19I3O3 — CID 118275799
2,2,3-triiododecane-1,1,1-triol (PubChem CID 118275799) has the molecular formula C10H19I3O3 and a molecular weight of 567.97 g/mol. Its IUPAC name is 2,2,3-triiododecane-1,1,1-triol.
| Compound Name | 2,2,3-triiododecane-1,1,1-triol |
|---|---|
| PubChem CID | 118275799 |
| Molecular Formula | C10H19I3O3 |
| Molecular Weight | 567.97 g/mol |
| Exact Mass | 567.85 |
| IUPAC Name | 2,2,3-triiododecane-1,1,1-triol |
| SMILES | CCCCCCCC(I)C(I)(I)C(O)(O)O |
| InChI | InChI=1S/C10H19I3O3/c1-2-3-4-5-6-7-8(11)9(12,13)10(14,15)16/h8,14-16H,2-7H2,1H3 |
| InChIKey | VKTJFDCROBPERL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.97 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|