C5H7I3O — CID 118275868
(E)-1,2,3-triiodopent-1-en-1-ol (PubChem CID 118275868) has the molecular formula C5H7I3O and a molecular weight of 463.82 g/mol. Its IUPAC name is (E)-1,2,3-triiodopent-1-en-1-ol.
| Compound Name | (E)-1,2,3-triiodopent-1-en-1-ol |
|---|---|
| PubChem CID | 118275868 |
| Molecular Formula | C5H7I3O |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.76 |
| IUPAC Name | (E)-1,2,3-triiodopent-1-en-1-ol |
| SMILES | CCC(I)/C(I)=C(/O)I |
| InChI | InChI=1S/C5H7I3O/c1-2-3(6)4(7)5(8)9/h3,9H,2H2,1H3/b5-4- |
| InChIKey | ZFWPXUSOVOLYKA-PLNGDYQASA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|