C10H19NO5S — CID 118276877
[2-(ethylamino)-1-methoxysulfonylpropyl] 2-methylprop-2-enoate (PubChem CID 118276877) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is [2-(ethylamino)-1-methoxysulfonylpropyl] 2-methylprop-2-enoate.
| Compound Name | [2-(ethylamino)-1-methoxysulfonylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118276877 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [2-(ethylamino)-1-methoxysulfonylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(C)NCC)S(=O)(=O)OC |
| InChI | InChI=1S/C10H19NO5S/c1-6-11-8(4)10(17(13,14)15-5)16-9(12)7(2)3/h8,10-11H,2,6H2,1,3-5H3 |
| InChIKey | IYBVYYYGABXRHV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|