C12H25NO6S — CID 173435618
methyl hydrogen sulfate;2-(pentan-3-ylamino)ethyl 2-methylprop-2-enoate (PubChem CID 173435618) has the molecular formula C12H25NO6S and a molecular weight of 311.40 g/mol. Its IUPAC name is methyl hydrogen sulfate;2-(pentan-3-ylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | methyl hydrogen sulfate;2-(pentan-3-ylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173435618 |
| Molecular Formula | C12H25NO6S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | methyl hydrogen sulfate;2-(pentan-3-ylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(CC)CC.COS(=O)(=O)O |
| InChI | InChI=1S/C11H21NO2.CH4O4S/c1-5-10(6-2)12-7-8-14-11(13)9(3)4;1-5-6(2,3)4/h10,12H,3,5-8H2,1-2,4H3;1H3,(H,2,3,4) |
| InChIKey | KZAUHAFARZNLFF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|