C13H28ClNO6S — CID 174732478
methyl hydrogen sulfate;trimethyl-[2-methyl-4-(2-methylprop-2-enoyloxy)butan-2-yl]azanium;chloride (PubChem CID 174732478) has the molecular formula C13H28ClNO6S and a molecular weight of 361.89 g/mol. Its IUPAC name is methyl hydrogen sulfate;trimethyl-[2-methyl-4-(2-methylprop-2-enoyloxy)butan-2-yl]azanium;chloride.
| Compound Name | methyl hydrogen sulfate;trimethyl-[2-methyl-4-(2-methylprop-2-enoyloxy)butan-2-yl]azanium;chloride |
|---|---|
| PubChem CID | 174732478 |
| Molecular Formula | C13H28ClNO6S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl hydrogen sulfate;trimethyl-[2-methyl-4-(2-methylprop-2-enoyloxy)butan-2-yl]azanium;chloride |
| SMILES | C=C(C)C(=O)OCCC(C)(C)[N+](C)(C)C.COS(=O)(=O)O.[Cl-] |
| InChI | InChI=1S/C12H24NO2.CH4O4S.ClH/c1-10(2)11(14)15-9-8-12(3,4)13(5,6)7;1-5-6(2,3)4;/h1,8-9H2,2-7H3;1H3,(H,2,3,4);1H/q+1;;/p-1 |
| InChIKey | ROGYFNIIQUMGNH-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|