C15H22N2O5 — CID 118277119
(2S)-2-[(2,5-dioxopyrrol-1-yl)-hexanoylamino]-3-methylbutanoic acid (PubChem CID 118277119) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S)-2-[(2,5-dioxopyrrol-1-yl)-hexanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(2,5-dioxopyrrol-1-yl)-hexanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 118277119 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S)-2-[(2,5-dioxopyrrol-1-yl)-hexanoylamino]-3-methylbutanoic acid |
| SMILES | CCCCCC(=O)N([C@H](C(=O)O)C(C)C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H22N2O5/c1-4-5-6-7-11(18)17(14(10(2)3)15(21)22)16-12(19)8-9-13(16)20/h8-10,14H,4-7H2,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | SKEHSMOFNLEESO-AWEZNQCLSA-N |
| XLogP | 1.34 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|