C13H18N2O5 — CID 68673812
2-[(2,5-dioxopyrrol-1-yl)-propanoylamino]hexanoic acid (PubChem CID 68673812) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(2,5-dioxopyrrol-1-yl)-propanoylamino]hexanoic acid.
| Compound Name | 2-[(2,5-dioxopyrrol-1-yl)-propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 68673812 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[(2,5-dioxopyrrol-1-yl)-propanoylamino]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N(C(=O)CC)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H18N2O5/c1-3-5-6-9(13(19)20)14(10(16)4-2)15-11(17)7-8-12(15)18/h7-9H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | BRBIWTFRJJGQOP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|