C15H22N2O5 — CID 77196582
2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoic acid (PubChem CID 77196582) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 77196582 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C15H22N2O5/c1-10(2)14(15(21)22)16-11(18)6-4-3-5-9-17-12(19)7-8-13(17)20/h7-8,10,14H,3-6,9H2,1-2H3,(H,16,18)(H,21,22) |
| InChIKey | OKLMYGIYGMPXPN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|