C17H27NO3S — CID 118277995
(NE,R)-N-[4-(4-hydroxy-3-propan-2-yloxyphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 118277995) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is (NE,R)-N-[4-(4-hydroxy-3-propan-2-yloxyphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[4-(4-hydroxy-3-propan-2-yloxyphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118277995 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (NE,R)-N-[4-(4-hydroxy-3-propan-2-yloxyphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(CCc1ccc(O)c(OC(C)C)c1)=N\[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C17H27NO3S/c1-12(2)21-16-11-14(9-10-15(16)19)8-7-13(3)18-22(20)17(4,5)6/h9-12,19H,7-8H2,1-6H3/b18-13+/t22-/m1/s1 |
| InChIKey | HLNHAUXWVSHXPJ-MKRMIXIUSA-N |
| XLogP | 4.04 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|