C19H42N6 — CID 118278399
1-[1-(4,7-dimethyl-1,4,7-triazonan-1-yl)propyl]-4,7-dimethyl-1,4,7-triazonane (PubChem CID 118278399) has the molecular formula C19H42N6 and a molecular weight of 354.59 g/mol. Its IUPAC name is 1-[1-(4,7-dimethyl-1,4,7-triazonan-1-yl)propyl]-4,7-dimethyl-1,4,7-triazonane.
| Compound Name | 1-[1-(4,7-dimethyl-1,4,7-triazonan-1-yl)propyl]-4,7-dimethyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 118278399 |
| Molecular Formula | C19H42N6 |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 1-[1-(4,7-dimethyl-1,4,7-triazonan-1-yl)propyl]-4,7-dimethyl-1,4,7-triazonane |
| SMILES | CCC(N1CCN(C)CCN(C)CC1)N1CCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C19H42N6/c1-6-19(24-15-11-20(2)7-8-21(3)12-16-24)25-17-13-22(4)9-10-23(5)14-18-25/h19H,6-18H2,1-5H3 |
| InChIKey | WOSUVEQFTYPEFB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |