C25H35FO — CID 118283710
1-(3-fluoro-2,4-dimethylphenyl)-2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethanone (PubChem CID 118283710) has the molecular formula C25H35FO and a molecular weight of 370.55 g/mol. Its IUPAC name is 1-(3-fluoro-2,4-dimethylphenyl)-2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethanone.
| Compound Name | 1-(3-fluoro-2,4-dimethylphenyl)-2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethanone |
|---|---|
| PubChem CID | 118283710 |
| Molecular Formula | C25H35FO |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-(3-fluoro-2,4-dimethylphenyl)-2-[4-(4-propylcyclohexyl)cyclohexen-1-yl]ethanone |
| SMILES | CCCC1CCC(C2CC=C(CC(=O)c3ccc(C)c(F)c3C)CC2)CC1 |
| InChI | InChI=1S/C25H35FO/c1-4-5-19-7-11-21(12-8-19)22-13-9-20(10-14-22)16-24(27)23-15-6-17(2)25(26)18(23)3/h6,9,15,19,21-22H,4-5,7-8,10-14,16H2,1-3H3 |
| InChIKey | PCKJZSWRBGGPON-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|