C21H27F2N3O3 — CID 118286104
(2R)-N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-2-[[4-(1,1-difluoroethyl)phenyl]methyl]pentanamide (PubChem CID 118286104) has the molecular formula C21H27F2N3O3 and a molecular weight of 407.46 g/mol. Its IUPAC name is (2R)-N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-2-[[4-(1,1-difluoroethyl)phenyl]methyl]pentanamide.
| Compound Name | (2R)-N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-2-[[4-(1,1-difluoroethyl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 118286104 |
| Molecular Formula | C21H27F2N3O3 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (2R)-N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-2-[[4-(1,1-difluoroethyl)phenyl]methyl]pentanamide |
| SMILES | CCC[C@H](Cc1ccc(C(C)(F)F)cc1)C(=O)NC[C@@]1(C2CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H27F2N3O3/c1-3-4-14(11-13-5-7-15(8-6-13)20(2,22)23)17(27)24-12-21(16-9-10-16)18(28)25-19(29)26-21/h5-8,14,16H,3-4,9-12H2,1-2H3,(H,24,27)(H2,25,26,28,29)/t14-,21+/m1/s1 |
| InChIKey | YMTTZABZWVFYKR-SZNDQCEHSA-N |
| XLogP | 2.86 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|