About 3,3-difluoropropylbenzene
3,3-difluoropropylbenzene (PubChem CID 11829680) has the molecular formula C9H10F2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3,3-difluoropropylbenzene.
Molecular Properties
| Compound Name | 3,3-difluoropropylbenzene |
| PubChem CID | 11829680 |
| Molecular Formula | C9H10F2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3,3-difluoropropylbenzene |
| SMILES | FC(F)CCc1ccccc1 |
| InChI | InChI=1S/C9H10F2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | SBJSSUDWLOQFRO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,3-difluoropropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoropropylbenzene?
The IUPAC name of 3,3-difluoropropylbenzene (CID 11829680) is 3,3-difluoropropylbenzene.
What is the SMILES notation for 3,3-difluoropropylbenzene?
The canonical SMILES for 3,3-difluoropropylbenzene is FC(F)CCc1ccccc1.
What is the InChIKey of 3,3-difluoropropylbenzene?
The InChIKey is SBJSSUDWLOQFRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of 3,3-difluoropropylbenzene?
3,3-difluoropropylbenzene has a molecular weight of 156.18 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoropropylbenzene is sourced from PubChem (CID 11829680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).