C11H17NO2 — CID 11830333
2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide (PubChem CID 11830333) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide.
| Compound Name | 2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 11830333 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,N-dimethylethanamine oxide |
| SMILES | COc1ccc(CC[N+](C)(C)[O-])cc1 |
| InChI | InChI=1S/C11H17NO2/c1-12(2,13)9-8-10-4-6-11(14-3)7-5-10/h4-7H,8-9H2,1-3H3 |
| InChIKey | XQRXCTHLSQQLND-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|