About potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane
potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane (PubChem CID 71613554) has the molecular formula C18H22KO2PSSe
and a molecular weight of 451.47 g/mol. Its IUPAC name is potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane.
Molecular Properties
| Compound Name | potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane |
| PubChem CID | 71613554 |
| Molecular Formula | C18H22KO2PSSe |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane |
| SMILES | COc1ccc(CCP([S-])(=[Se])CCc2ccc(OC)cc2)cc1.[K+] |
| InChI | InChI=1S/C18H23O2PSSe.K/c1-19-17-7-3-15(4-8-17)11-13-21(22,23)14-12-16-5-9-18(20-2)10-6-16;/h3-10H,11-14H2,1-2H3,(H,22,23);/q;+1/p-1 |
| InChIKey | XUQXCXPUPJAHIY-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane?
The IUPAC name of potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane (CID 71613554) is potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane.
What is the SMILES notation for potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane?
The canonical SMILES for potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane is COc1ccc(CCP([S-])(=[Se])CCc2ccc(OC)cc2)cc1.[K+].
What is the InChIKey of potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane?
The InChIKey is XUQXCXPUPJAHIY-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H23O2PSSe.K/c1-19-17-7-3-15(4-8-17)11-13-21(22,23)14-12-16-5-9-18(20-2)10-6-16;/h3-10H,11-14H2,1-2H3,(H,22,23);/q;+1/p-1.
What are the key properties of potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane?
potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane has a molecular weight of 451.47 g/mol, XLogP of 1.06, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium bis[2-(4-methoxyphenyl)ethyl]-selanylidene-sulfido-λ5-phosphane is sourced from PubChem (CID 71613554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).