C23H29FN4O4S — CID 118306484
N-[(4-fluorophenyl)methyl]-11-hydroxy-4-(3-methylsulfanylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradec-10-ene-13-carboxamide (PubChem CID 118306484) has the molecular formula C23H29FN4O4S and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-11-hydroxy-4-(3-methylsulfanylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradec-10-ene-13-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-11-hydroxy-4-(3-methylsulfanylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradec-10-ene-13-carboxamide |
|---|---|
| PubChem CID | 118306484 |
| Molecular Formula | C23H29FN4O4S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-11-hydroxy-4-(3-methylsulfanylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradec-10-ene-13-carboxamide |
| SMILES | CSCCCN1CCCN2C(=O)C3=C(O)C(=O)C(C(=O)NCc4ccc(F)cc4)CN3CC12 |
| InChI | InChI=1S/C23H29FN4O4S/c1-33-11-3-9-26-8-2-10-28-18(26)14-27-13-17(20(29)21(30)19(27)23(28)32)22(31)25-12-15-4-6-16(24)7-5-15/h4-7,17-18,30H,2-3,8-14H2,1H3,(H,25,31) |
| InChIKey | PRRKWRNKGVNZOF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|