C15H23N — CID 118307215
(5E)-4,5-bis(prop-2-enyl)nona-1,5,8-trien-4-amine (PubChem CID 118307215) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (5E)-4,5-bis(prop-2-enyl)nona-1,5,8-trien-4-amine.
| Compound Name | (5E)-4,5-bis(prop-2-enyl)nona-1,5,8-trien-4-amine |
|---|---|
| PubChem CID | 118307215 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (5E)-4,5-bis(prop-2-enyl)nona-1,5,8-trien-4-amine |
| SMILES | C=CC/C=C(\CC=C)C(N)(CC=C)CC=C |
| InChI | InChI=1S/C15H23N/c1-5-9-11-14(10-6-2)15(16,12-7-3)13-8-4/h5-8,11H,1-4,9-10,12-13,16H2/b14-11+ |
| InChIKey | SADNWADXQNWZTP-SDNWHVSQSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|