C11H15F3 — CID 20817575
(4E)-8-methyl-4-(trifluoromethyl)nona-1,4,7-triene (PubChem CID 20817575) has the molecular formula C11H15F3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (4E)-8-methyl-4-(trifluoromethyl)nona-1,4,7-triene.
| Compound Name | (4E)-8-methyl-4-(trifluoromethyl)nona-1,4,7-triene |
|---|---|
| PubChem CID | 20817575 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (4E)-8-methyl-4-(trifluoromethyl)nona-1,4,7-triene |
| SMILES | C=CC/C(=C\CC=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3/c1-4-6-10(11(12,13)14)8-5-7-9(2)3/h4,7-8H,1,5-6H2,2-3H3/b10-8+ |
| InChIKey | OBARUYMNMOFOIB-CSKARUKUSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|