C17H18F4N6O — CID 118307985
N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 118307985) has the molecular formula C17H18F4N6O and a molecular weight of 398.36 g/mol. Its IUPAC name is N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 118307985 |
| Molecular Formula | C17H18F4N6O |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1cnc(C(=O)Nc2ccc(F)c([C@@]3(C)N=C(N)[C@@](C)(F)CC3(F)F)c2)n1 |
| InChI | InChI=1S/C17H18F4N6O/c1-15(19)7-17(20,21)16(2,25-14(15)22)10-6-9(4-5-11(10)18)24-13(28)12-23-8-27(3)26-12/h4-6,8H,7H2,1-3H3,(H2,22,25)(H,24,28)/t15-,16+/m0/s1 |
| InChIKey | ZADSHEURMUBVAC-JKSUJKDBSA-N |
| XLogP | 2.55 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |