C27H34N6O2 — CID 44601560
N-(3,4-dimethylphenyl)-1-[2-oxo-2-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]ethyl]-1,2,4-triazole-3-carboxamide (PubChem CID 44601560) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-[2-oxo-2-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]ethyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-[2-oxo-2-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]ethyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 44601560 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-[2-oxo-2-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]ethyl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc(C)c(CN2CCN(C(=O)Cn3cnc(C(=O)Nc4ccc(C)c(C)c4)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C27H34N6O2/c1-18-12-21(4)24(22(5)13-18)15-31-8-10-32(11-9-31)25(34)16-33-17-28-26(30-33)27(35)29-23-7-6-19(2)20(3)14-23/h6-7,12-14,17H,8-11,15-16H2,1-5H3,(H,29,35) |
| InChIKey | FMIMLAQUIOHKDF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |