C22H27N5O — CID 45281072
1-[3-(3,4-dimethylanilino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 45281072) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[3-(3,4-dimethylanilino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[3-(3,4-dimethylanilino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 45281072 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[3-(3,4-dimethylanilino)propyl]-N-(3,4-dimethylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(NCCCn2cnc(C(=O)Nc3ccc(C)c(C)c3)n2)cc1C |
| InChI | InChI=1S/C22H27N5O/c1-15-6-8-19(12-17(15)3)23-10-5-11-27-14-24-21(26-27)22(28)25-20-9-7-16(2)18(4)13-20/h6-9,12-14,23H,5,10-11H2,1-4H3,(H,25,28) |
| InChIKey | VRVUDVTUWYKKDT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|