C32H30N4O9P+ — CID 118309538
bis[(4-carbamoylphenyl)-[formyl(phenylmethoxy)amino]methoxy]-oxophosphanium (PubChem CID 118309538) has the molecular formula C32H30N4O9P+ and a molecular weight of 645.59 g/mol. Its IUPAC name is bis[(4-carbamoylphenyl)-[formyl(phenylmethoxy)amino]methoxy]-oxophosphanium.
| Compound Name | bis[(4-carbamoylphenyl)-[formyl(phenylmethoxy)amino]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 118309538 |
| Molecular Formula | C32H30N4O9P+ |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | bis[(4-carbamoylphenyl)-[formyl(phenylmethoxy)amino]methoxy]-oxophosphanium |
| SMILES | NC(=O)c1ccc(C(O[P+](=O)OC(c2ccc(C(N)=O)cc2)N(C=O)OCc2ccccc2)N(C=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H29N4O9P/c33-29(39)25-11-15-27(16-12-25)31(35(21-37)42-19-23-7-3-1-4-8-23)44-46(41)45-32(28-17-13-26(14-18-28)30(34)40)36(22-38)43-20-24-9-5-2-6-10-24/h1-18,21-22,31-32H,19-20H2,(H3-,33,34,39,40)/p+1 |
| InChIKey | QFZHNYXOXJQFGW-UHFFFAOYSA-O |
| XLogP | 4.45 |
| TPSA | 180.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|