C19H21NO4 — CID 87482906
N-[(1S)-1-(1,3-dioxolan-2-yl)-2-phenylethyl]-N-phenylmethoxyformamide (PubChem CID 87482906) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-dioxolan-2-yl)-2-phenylethyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(1S)-1-(1,3-dioxolan-2-yl)-2-phenylethyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 87482906 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(1S)-1-(1,3-dioxolan-2-yl)-2-phenylethyl]-N-phenylmethoxyformamide |
| SMILES | O=CN(OCc1ccccc1)[C@@H](Cc1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C19H21NO4/c21-15-20(24-14-17-9-5-2-6-10-17)18(19-22-11-12-23-19)13-16-7-3-1-4-8-16/h1-10,15,18-19H,11-14H2/t18-/m0/s1 |
| InChIKey | BOYLHOGWQBZTDK-SFHVURJKSA-N |
| XLogP | 2.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|