C39H46NO6P — CID 118442063
N-[(E,4S,5R,6R)-8-dimethylphosphoryl-4,5,6-tris(phenylmethoxy)oct-7-en-3-yl]-N-phenylmethoxyformamide (PubChem CID 118442063) has the molecular formula C39H46NO6P and a molecular weight of 655.77 g/mol. Its IUPAC name is N-[(E,4S,5R,6R)-8-dimethylphosphoryl-4,5,6-tris(phenylmethoxy)oct-7-en-3-yl]-N-phenylmethoxyformamide.
| Compound Name | N-[(E,4S,5R,6R)-8-dimethylphosphoryl-4,5,6-tris(phenylmethoxy)oct-7-en-3-yl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 118442063 |
| Molecular Formula | C39H46NO6P |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.31 |
| IUPAC Name | N-[(E,4S,5R,6R)-8-dimethylphosphoryl-4,5,6-tris(phenylmethoxy)oct-7-en-3-yl]-N-phenylmethoxyformamide |
| SMILES | CCC([C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](/C=C/P(C)(C)=O)OCc1ccccc1)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H46NO6P/c1-4-36(40(31-41)46-30-35-23-15-8-16-24-35)38(44-28-33-19-11-6-12-20-33)39(45-29-34-21-13-7-14-22-34)37(25-26-47(2,3)42)43-27-32-17-9-5-10-18-32/h5-26,31,36-39H,4,27-30H2,1-3H3/b26-25+/t36?,37-,38+,39-/m1/s1 |
| InChIKey | DAYNIMZUEAAEST-CUTTXUGTSA-N |
| XLogP | 8.25 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|