C37H42NO8P — CID 118433503
N-[(E,2R,3S,4R)-6-dimethoxyphosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide (PubChem CID 118433503) has the molecular formula C37H42NO8P and a molecular weight of 659.72 g/mol. Its IUPAC name is N-[(E,2R,3S,4R)-6-dimethoxyphosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(E,2R,3S,4R)-6-dimethoxyphosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 118433503 |
| Molecular Formula | C37H42NO8P |
| Molecular Weight | 659.72 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | N-[(E,2R,3S,4R)-6-dimethoxyphosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide |
| SMILES | COP(=O)(/C=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](CN(C=O)OCc1ccccc1)OCc1ccccc1)OC |
| InChI | InChI=1S/C37H42NO8P/c1-41-47(40,42-2)24-23-35(43-26-31-15-7-3-8-16-31)37(45-28-33-19-11-5-12-20-33)36(44-27-32-17-9-4-10-18-32)25-38(30-39)46-29-34-21-13-6-14-22-34/h3-24,30,35-37H,25-29H2,1-2H3/b24-23+/t35-,36-,37+/m1/s1 |
| InChIKey | PKBPKAIDPIHEOQ-UACLATIDSA-N |
| XLogP | 7.33 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.72 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|