C15H23NO7P+ — CID 90138759
[(3R,4R,5S)-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-methoxy-oxophosphanium (PubChem CID 90138759) has the molecular formula C15H23NO7P+ and a molecular weight of 360.32 g/mol. Its IUPAC name is [(3R,4R,5S)-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-methoxy-oxophosphanium.
| Compound Name | [(3R,4R,5S)-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 90138759 |
| Molecular Formula | C15H23NO7P+ |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [(3R,4R,5S)-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-methoxy-oxophosphanium |
| SMILES | CO[P+](=O)CC[C@@H](O)[C@@H](O)[C@@H](O)CN(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H23NO7P/c1-22-24(21)8-7-13(18)15(20)14(19)9-16(11-17)23-10-12-5-3-2-4-6-12/h2-6,11,13-15,18-20H,7-10H2,1H3/q+1/t13-,14+,15-/m1/s1 |
| InChIKey | ULLYYNLVOXNKJO-QLFBSQMISA-N |
| XLogP | 0.44 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|