C43H48NO8P — CID 118442114
N-[(2S,3S,4R)-5-hydroxy-6-[methyl(phenylmethoxy)phosphoryl]-2,3,4-tris(phenylmethoxy)hexyl]-N-phenylmethoxyformamide (PubChem CID 118442114) has the molecular formula C43H48NO8P and a molecular weight of 737.83 g/mol. Its IUPAC name is N-[(2S,3S,4R)-5-hydroxy-6-[methyl(phenylmethoxy)phosphoryl]-2,3,4-tris(phenylmethoxy)hexyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2S,3S,4R)-5-hydroxy-6-[methyl(phenylmethoxy)phosphoryl]-2,3,4-tris(phenylmethoxy)hexyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 118442114 |
| Molecular Formula | C43H48NO8P |
| Molecular Weight | 737.83 g/mol |
| Exact Mass | 737.31 |
| IUPAC Name | N-[(2S,3S,4R)-5-hydroxy-6-[methyl(phenylmethoxy)phosphoryl]-2,3,4-tris(phenylmethoxy)hexyl]-N-phenylmethoxyformamide |
| SMILES | CP(=O)(CC(O)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](CN(C=O)OCc1ccccc1)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C43H48NO8P/c1-53(47,52-32-39-25-15-6-16-26-39)33-40(46)42(49-29-36-19-9-3-10-20-36)43(50-30-37-21-11-4-12-22-37)41(48-28-35-17-7-2-8-18-35)27-44(34-45)51-31-38-23-13-5-14-24-38/h2-26,34,40-43,46H,27-33H2,1H3/t40?,41-,42+,43-,53?/m0/s1 |
| InChIKey | NTZWMOFTUXKENM-RBUGXZTASA-N |
| XLogP | 7.82 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.83 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|