C16H23F2NNaO8P — CID 131744078
sodium [(3R,4R,5S)-1,1-difluoro-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-ethoxyphosphinate (PubChem CID 131744078) has the molecular formula C16H23F2NNaO8P and a molecular weight of 449.32 g/mol. Its IUPAC name is sodium [(3R,4R,5S)-1,1-difluoro-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-ethoxyphosphinate.
| Compound Name | sodium [(3R,4R,5S)-1,1-difluoro-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-ethoxyphosphinate |
|---|---|
| PubChem CID | 131744078 |
| Molecular Formula | C16H23F2NNaO8P |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | sodium [(3R,4R,5S)-1,1-difluoro-6-[formyl(phenylmethoxy)amino]-3,4,5-trihydroxyhexyl]-ethoxyphosphinate |
| SMILES | CCOP(=O)([O-])C(F)(F)C[C@@H](O)[C@@H](O)[C@@H](O)CN(C=O)OCc1ccccc1.[Na+] |
| InChI | InChI=1S/C16H24F2NO8P.Na/c1-2-27-28(24,25)16(17,18)8-13(21)15(23)14(22)9-19(11-20)26-10-12-6-4-3-5-7-12;/h3-7,11,13-15,21-23H,2,8-10H2,1H3,(H,24,25);/q;+1/p-1/t13-,14+,15-;/m1./s1 |
| InChIKey | MNUGNRCCIXISDR-USAYTKQKSA-M |
| XLogP | -2.76 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|