C49H50NO8P — CID 134524547
N-[(E,2S,3R,4R)-6-bis(phenylmethoxy)phosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide (PubChem CID 134524547) has the molecular formula C49H50NO8P and a molecular weight of 811.91 g/mol. Its IUPAC name is N-[(E,2S,3R,4R)-6-bis(phenylmethoxy)phosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(E,2S,3R,4R)-6-bis(phenylmethoxy)phosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 134524547 |
| Molecular Formula | C49H50NO8P |
| Molecular Weight | 811.91 g/mol |
| Exact Mass | 811.33 |
| IUPAC Name | N-[(E,2S,3R,4R)-6-bis(phenylmethoxy)phosphoryl-2,3,4-tris(phenylmethoxy)hex-5-enyl]-N-phenylmethoxyformamide |
| SMILES | O=CN(C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](/C=C/P(=O)(OCc1ccccc1)OCc1ccccc1)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C49H50NO8P/c51-40-50(56-37-44-25-13-4-14-26-44)33-48(54-35-42-21-9-2-10-22-42)49(55-36-43-23-11-3-12-24-43)47(53-34-41-19-7-1-8-20-41)31-32-59(52,57-38-45-27-15-5-16-28-45)58-39-46-29-17-6-18-30-46/h1-32,40,47-49H,33-39H2/b32-31+/t47-,48+,49-/m1/s1 |
| InChIKey | YVXNHLSCZWJVOT-HXHAPULLSA-N |
| XLogP | 10.47 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.91 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|