C19H17F6P — CID 118312844
[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-[(1R)-1-phenylprop-2-enyl]phosphane (PubChem CID 118312844) has the molecular formula C19H17F6P and a molecular weight of 390.31 g/mol. Its IUPAC name is [(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-[(1R)-1-phenylprop-2-enyl]phosphane.
| Compound Name | [(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-[(1R)-1-phenylprop-2-enyl]phosphane |
|---|---|
| PubChem CID | 118312844 |
| Molecular Formula | C19H17F6P |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-[(1R)-1-phenylprop-2-enyl]phosphane |
| SMILES | C=C[C@@H](P[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H17F6P/c1-3-17(13-7-5-4-6-8-13)26-12(2)14-9-15(18(20,21)22)11-16(10-14)19(23,24)25/h3-12,17,26H,1H2,2H3/t12-,17-/m1/s1 |
| InChIKey | OUIOJLKLDBAAGN-SJKOYZFVSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|