C18H15BrS — CID 118312983
2-bromo-8,10,10-trimethylindeno[1,2-b][1]benzothiole (PubChem CID 118312983) has the molecular formula C18H15BrS and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-bromo-8,10,10-trimethylindeno[1,2-b][1]benzothiole.
| Compound Name | 2-bromo-8,10,10-trimethylindeno[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 118312983 |
| Molecular Formula | C18H15BrS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-bromo-8,10,10-trimethylindeno[1,2-b][1]benzothiole |
| SMILES | Cc1ccc2sc3c(c2c1)C(C)(C)c1cc(Br)ccc1-3 |
| InChI | InChI=1S/C18H15BrS/c1-10-4-7-15-13(8-10)16-17(20-15)12-6-5-11(19)9-14(12)18(16,2)3/h4-9H,1-3H3 |
| InChIKey | VNWAHGKOKWWPKE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |