C20H30N2O4S — CID 118314241
2-[1-[1-(benzenesulfonyl)piperidin-4-yl]-6-(2-hydroxyethyl)piperidin-2-yl]acetaldehyde (PubChem CID 118314241) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[1-[1-(benzenesulfonyl)piperidin-4-yl]-6-(2-hydroxyethyl)piperidin-2-yl]acetaldehyde.
| Compound Name | 2-[1-[1-(benzenesulfonyl)piperidin-4-yl]-6-(2-hydroxyethyl)piperidin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 118314241 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[1-[1-(benzenesulfonyl)piperidin-4-yl]-6-(2-hydroxyethyl)piperidin-2-yl]acetaldehyde |
| SMILES | O=CCC1CCCC(CCO)N1C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N2O4S/c23-15-11-17-5-4-6-18(12-16-24)22(17)19-9-13-21(14-10-19)27(25,26)20-7-2-1-3-8-20/h1-3,7-8,15,17-19,24H,4-6,9-14,16H2 |
| InChIKey | JVHNGCRRTLVBJK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|