C14H26O3Si — CID 11832485
[tert-butyl(dimethyl)silyl] 2-[(2R,6S)-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 11832485) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[(2R,6S)-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[(2R,6S)-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 11832485 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[(2R,6S)-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | C[C@@H]1CC=C[C@H](CC(=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H26O3Si/c1-11-8-7-9-12(16-11)10-13(15)17-18(5,6)14(2,3)4/h7,9,11-12H,8,10H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | PMEYHHBHEKUHFJ-VXGBXAGGSA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|