C22H42O5Si2 — CID 134882974
[tert-butyl(dimethyl)silyl] 2-[(2S,3R,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 134882974) has the molecular formula C22H42O5Si2 and a molecular weight of 442.75 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[(2S,3R,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[(2S,3R,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 134882974 |
| Molecular Formula | C22H42O5Si2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[(2S,3R,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-2-methyl-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | C=C(O[C@@H]1C=C[C@H](CC(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O5Si2/c1-16-19(25-17(2)26-28(9,10)21(3,4)5)14-13-18(24-16)15-20(23)27-29(11,12)22(6,7)8/h13-14,16,18-19H,2,15H2,1,3-12H3/t16-,18+,19+/m0/s1 |
| InChIKey | PBNYWFZUSDCALX-QXAKKESOSA-N |
| XLogP | 6.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|