C22H42O4Si2 — CID 11270268
[(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-triethylsilylethenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 11270268) has the molecular formula C22H42O4Si2 and a molecular weight of 426.75 g/mol. Its IUPAC name is [(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-triethylsilylethenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-triethylsilylethenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11270268 |
| Molecular Formula | C22H42O4Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | [(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-triethylsilylethenyl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC[Si](/C=C/[C@H]1O[C@H](COC(C)=O)C=C[C@H]1O[Si](C)(C)C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C22H42O4Si2/c1-10-28(11-2,12-3)16-15-20-21(26-27(8,9)22(5,6)7)14-13-19(25-20)17-24-18(4)23/h13-16,19-21H,10-12,17H2,1-9H3/b16-15+/t19-,20+,21+/m0/s1 |
| InChIKey | AAHGIZPYLGDJCT-OLZZWBPDSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|