C21H40O5Si2 — CID 134882930
[tert-butyl(dimethyl)silyl] 2-[(3S,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 134882930) has the molecular formula C21H40O5Si2 and a molecular weight of 428.72 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[(3S,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[(3S,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 134882930 |
| Molecular Formula | C21H40O5Si2 |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[(3S,6S)-3-[1-[tert-butyl(dimethyl)silyl]oxyethenoxy]-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | C=C(O[C@H]1C=C[C@H](CC(=O)O[Si](C)(C)C(C)(C)C)OC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O5Si2/c1-16(25-27(8,9)20(2,3)4)24-18-13-12-17(23-15-18)14-19(22)26-28(10,11)21(5,6)7/h12-13,17-18H,1,14-15H2,2-11H3/t17-,18+/m1/s1 |
| InChIKey | WHGKBXLLCWDFHW-MSOLQXFVSA-N |
| XLogP | 5.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|