C20H31FN2O7 — CID 118325922
N-(6-aminohexyl)-2-fluoro-2-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide (PubChem CID 118325922) has the molecular formula C20H31FN2O7 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-fluoro-2-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide.
| Compound Name | N-(6-aminohexyl)-2-fluoro-2-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 118325922 |
| Molecular Formula | C20H31FN2O7 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-(6-aminohexyl)-2-fluoro-2-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
| SMILES | NCCCCCCNC(=O)C(F)c1ccccc1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H31FN2O7/c21-15(19(28)23-10-6-2-1-5-9-22)12-7-3-4-8-13(12)29-20-18(27)17(26)16(25)14(11-24)30-20/h3-4,7-8,14-18,20,24-27H,1-2,5-6,9-11,22H2,(H,23,28)/t14-,15?,16+,17+,18-,20-/m1/s1 |
| InChIKey | ANKJDVKJXDNECE-DFMAAPGQSA-N |
| XLogP | -0.49 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|