C21H32FNO7 — CID 159712737
9-amino-1-fluoro-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]nonan-2-one (PubChem CID 159712737) has the molecular formula C21H32FNO7 and a molecular weight of 429.49 g/mol. Its IUPAC name is 9-amino-1-fluoro-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]nonan-2-one.
| Compound Name | 9-amino-1-fluoro-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]nonan-2-one |
|---|---|
| PubChem CID | 159712737 |
| Molecular Formula | C21H32FNO7 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 9-amino-1-fluoro-1-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]nonan-2-one |
| SMILES | NCCCCCCCC(=O)C(F)c1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C21H32FNO7/c22-17(15(25)6-4-2-1-3-5-11-23)13-7-9-14(10-8-13)29-21-20(28)19(27)18(26)16(12-24)30-21/h7-10,16-21,24,26-28H,1-6,11-12,23H2 |
| InChIKey | ZOIMYEZYGXQBJD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|