C42H48Br4N2O4 — CID 118326331
2,6-bis(2,6-dibromo-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 118326331) has the molecular formula C42H48Br4N2O4 and a molecular weight of 964.47 g/mol. Its IUPAC name is 2,6-bis(2,6-dibromo-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(2,6-dibromo-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 118326331 |
| Molecular Formula | C42H48Br4N2O4 |
| Molecular Weight | 964.47 g/mol |
| Exact Mass | 960.03 |
| IUPAC Name | 2,6-bis(2,6-dibromo-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCCCCCCCCc1cc(Br)c(-n2c(=O)c3cc4c(=O)n(-c5c(Br)cc(CCCCCCCCCC)cc5Br)c(=O)c4cc3c2=O)c(Br)c1 |
| InChI | InChI=1S/C42H48Br4N2O4/c1-3-5-7-9-11-13-15-17-19-27-21-33(43)37(34(44)22-27)47-39(49)29-25-31-32(26-30(29)40(47)50)42(52)48(41(31)51)38-35(45)23-28(24-36(38)46)20-18-16-14-12-10-8-6-4-2/h21-26H,3-20H2,1-2H3 |
| InChIKey | UFKZALIWLPAQQU-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.47 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|