C50H60N2O8 — CID 118330625
2,6-bis(2,6-diacetyl-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 118330625) has the molecular formula C50H60N2O8 and a molecular weight of 817.04 g/mol. Its IUPAC name is 2,6-bis(2,6-diacetyl-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(2,6-diacetyl-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 118330625 |
| Molecular Formula | C50H60N2O8 |
| Molecular Weight | 817.04 g/mol |
| Exact Mass | 816.43 |
| IUPAC Name | 2,6-bis(2,6-diacetyl-4-decylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCCCCCCCCc1cc(C(C)=O)c(-n2c(=O)c3cc4c(=O)n(-c5c(C(C)=O)cc(CCCCCCCCCC)cc5C(C)=O)c(=O)c4cc3c2=O)c(C(C)=O)c1 |
| InChI | InChI=1S/C50H60N2O8/c1-7-9-11-13-15-17-19-21-23-35-25-37(31(3)53)45(38(26-35)32(4)54)51-47(57)41-29-43-44(30-42(41)48(51)58)50(60)52(49(43)59)46-39(33(5)55)27-36(28-40(46)34(6)56)24-22-20-18-16-14-12-10-8-2/h25-30H,7-24H2,1-6H3 |
| InChIKey | IDMKBMMCFIONPD-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 146.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.04 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|