C17H17N2O4P — CID 118329922
N-bis(phenylmethoxy)phosphoryl-1,2-oxazol-3-amine (PubChem CID 118329922) has the molecular formula C17H17N2O4P and a molecular weight of 344.31 g/mol. Its IUPAC name is N-bis(phenylmethoxy)phosphoryl-1,2-oxazol-3-amine.
| Compound Name | N-bis(phenylmethoxy)phosphoryl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 118329922 |
| Molecular Formula | C17H17N2O4P |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-bis(phenylmethoxy)phosphoryl-1,2-oxazol-3-amine |
| SMILES | O=P(Nc1ccon1)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H17N2O4P/c20-24(19-17-11-12-21-18-17,22-13-15-7-3-1-4-8-15)23-14-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,18,19,20) |
| InChIKey | CXQPESUXDUACIH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|