About sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride
sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride (PubChem CID 173399282) has the molecular formula C15H16N2NaO3P
and a molecular weight of 326.27 g/mol. Its IUPAC name is sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride.
Molecular Properties
| Compound Name | sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride |
| PubChem CID | 173399282 |
| Molecular Formula | C15H16N2NaO3P |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride |
| SMILES | N#CNP(=O)(OCc1ccccc1)OCc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C15H15N2O3P.Na.H/c16-13-17-21(18,19-11-14-7-3-1-4-8-14)20-12-15-9-5-2-6-10-15;;/h1-10H,11-12H2,(H,17,18);;/q;+1;-1 |
| InChIKey | LCTGFHAITXCTJC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride?
The IUPAC name of sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride (CID 173399282) is sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride.
What is the SMILES notation for sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride?
The canonical SMILES for sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride is N#CNP(=O)(OCc1ccccc1)OCc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride?
The InChIKey is LCTGFHAITXCTJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N2O3P.Na.H/c16-13-17-21(18,19-11-14-7-3-1-4-8-14)20-12-15-9-5-2-6-10-15;;/h1-10H,11-12H2,(H,17,18);;/q;+1;-1.
What are the key properties of sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride?
sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride has a molecular weight of 326.27 g/mol, XLogP of 0.72, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;bis(phenylmethoxy)phosphorylcyanamide;hydride is sourced from PubChem (CID 173399282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).