C16H11ClN2O2 — CID 11833456
4-chloro-9,11-dimethyl-15-oxa-8,12-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-16-one (PubChem CID 11833456) has the molecular formula C16H11ClN2O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 4-chloro-9,11-dimethyl-15-oxa-8,12-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-16-one.
| Compound Name | 4-chloro-9,11-dimethyl-15-oxa-8,12-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-16-one |
|---|---|
| PubChem CID | 11833456 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-chloro-9,11-dimethyl-15-oxa-8,12-diazatetracyclo[8.7.0.02,7.013,17]heptadeca-1,3,5,7,9,11,13(17)-heptaen-16-one |
| SMILES | Cc1nc2c(c3c1c(C)nc1ccc(Cl)cc13)C(=O)OC2 |
| InChI | InChI=1S/C16H11ClN2O2/c1-7-13-8(2)19-12-6-21-16(20)15(12)14(13)10-5-9(17)3-4-11(10)18-7/h3-5H,6H2,1-2H3 |
| InChIKey | BNVMUPGHKJDMEP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|